How startinpy works#
Original code written in rust#
startinpy source code in written in Rust (called just ‘startin’, original source code).
Robust arithmetic for the geometric predicates are used (Shewchuk’s predicates, well the Rust port of the code), so startin/py is robust and shouldn’t crash (touch wood).
Insertion + deletion are possible#
It uses an incremental algorithm for the construction of a Delaunay triangulation (constraints are not supported), that is each point are inserted one after another and triangulation is updated between each insertion. The algorithm is based on flips.
The deletion of a vertex is also possible. The algorithm implemented is a modification of the one of Mostafavi, Gold, and Dakowicz (2003). The ears are filled by flipping, so it’s in theory more robust. I have also extended the algorithm to allow the deletion of vertices on the boundary of the convex hull. The algorithm is sub-optimal, but in practice the number of neighbours of a given vertex in a DT is only 6, so it doesn’t really matter.
The data structure#
The data structure of the Rust code is a cheap implementation of the star-based structure defined in Blandford et al. (2003), cheap because the link of each vertex is stored a simple array and not in an optimised blob like they did. It results in a pretty fast library (comparison will come at some point), but it uses more space than the optimised one.
However, the stars are not exposed in startinpy to keep it a simple and higher-level library.
The data structure of startinpy has 2 arrays:
an array of Points, where each entry is an array of 3 floats (x-coordinate, y-coordinate, z-coordinate)
an array of Triangles, where each Triangle is an array of 3 integers, the values of the indices of the 3 vertices (ordered counter-clockwise) in the array of Points (
startinpy.DT.points(), which is 0-based, 0 being the infinite vertex).
A Vertex is an integer, it is the index in the array of points (startinpy.DT.points(), which is 0-based).
If you delete a vertex (with startinpy.DT.remove()) then the entry in the array of Points is not deleted (this would be slow because arrays are contiguous and a lot of copying would be necessary), instead the vertex/point is flagged as being removed and none of the Triangles will refer to it.
Infinite vertex and triangles#
The implementation of startinpy has infinite triangles and infinite vertex, this simplifies a lot the algorithm and ensures that one can insert new points outside the convex hull of a dataset (or even delete some vertices on the boundary of the convex hull). The CGAL library also does this, and it is well explained here.
The infinite vertex is the first vertex in the array of points (startinpy.DT.points()) and thus it has the index of 0 (zero).
It has infinite coordinates ([inf inf inf]), they are of type numpy infinity.
An infinite triangle is a triangle having the infinite vertex as one of its vertices.
In the figure, notice that there are 5 finite triangles (126, 236, 346, 456, 516), but the data structure actually stores 5 extra infinite triangles (102, 150, 540, 304, 203). Those are adjacent to the 5 edges on the boundary of the convex hull of the dataset.
Some examples of the data structure and infinity#
For instance, consider this 5-vertex Delaunay triangulation:
import startinpy
import numpy as np
np.set_printoptions(precision=10)
t = startinpy.DT()
t.insert_one_pt(0.5, 0.5, 1.0)
t.insert_one_pt(0.0, 0.0, 2.0)
t.insert_one_pt(1.0, 0.0, 3.0)
t.insert_one_pt(1.0, 1.0, 4.0)
t.insert_one_pt(0.0, 1.0, 5.0)
print(t.points)
print(t.triangles)
Which outputs this below. Notice first that there are 6 vertices: the 5 we inserted plus the infinite vertex (with dummy coordinates -99999.99999…). Notice also no finite triangles refers to the vertex 0.
[[inf inf inf]
[0.5 0.5 1. ]
[0. 0. 2. ]
[1. 0. 3. ]
[1. 1. 4. ]
[0. 1. 5. ]]
[[1 2 3]
[1 3 4]
[1 4 5]
[1 5 2]]
However, startinpy stores internally infinite triangles. For instance, if you retrieve the triangles incident to a given vertex on the convex hull:
re = t.incident_triangles_to_vertex(2)
for each in re:
print(each)
[2 0 3]
[2 3 1]
[2 1 5]
[2 5 0]
Also, if you remove one vertex (eg the one in the middle of the square, vertex 1), observe that now its coordinates are “Not a Number (nan)”, and that no triangle in the DT refers to it anymore:
t.remove(1)
print(t.points)
print(t.triangles)
print(t.is_vertex_removed(1))
[[inf inf inf]
[nan nan nan]
[ 0. 0. 2.]
[ 1. 0. 3.]
[ 1. 1. 4.]
[ 0. 1. 5.]]
[[2 3 4]
[2 4 5]]
True
Finally, you can remove the unused/deleted vertices from the startinpy.DT.points() array by using startinpy.DT.collect_garbage(), which will assign a new ID to most vertices and triangles will be updated too.
Notice that now 5 vertices are in the array, and only 2 finite triangles are in the DT.
t.collect_garbage()
print(t.points)
print(t.triangles)
[[inf inf inf]
[ 0. 0. 2.]
[ 1. 0. 3.]
[ 1. 1. 4.]
[ 0. 1. 5.]]
[[1 2 3]
[1 3 4]]